C15H18BrN3 — CID 105268027
[1-(3-bromo-2-pyridinyl)-2-(3,5-dimethylphenyl)ethyl]hydrazine (PubChem CID 105268027) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is [1-(3-bromo-2-pyridinyl)-2-(3,5-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-2-pyridinyl)-2-(3,5-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105268027 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [1-(3-bromo-2-pyridinyl)-2-(3,5-dimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(C)cc(CC(NN)c2ncccc2Br)c1 |
| InChI | InChI=1S/C15H18BrN3/c1-10-6-11(2)8-12(7-10)9-14(19-17)15-13(16)4-3-5-18-15/h3-8,14,19H,9,17H2,1-2H3 |
| InChIKey | XYKDXPWLIMQEGK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|