C13H12BrF2N3 — CID 105268167
[1-(3-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)ethyl]hydrazine (PubChem CID 105268167) has the molecular formula C13H12BrF2N3 and a molecular weight of 328.16 g/mol. Its IUPAC name is [1-(3-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105268167 |
| Molecular Formula | C13H12BrF2N3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [1-(3-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1F)c1ncccc1Br |
| InChI | InChI=1S/C13H12BrF2N3/c14-10-2-1-5-18-13(10)12(19-17)6-8-3-4-9(15)7-11(8)16/h1-5,7,12,19H,6,17H2 |
| InChIKey | BJBIKXNRLORIHW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|