C10H10Br2ClN5 — CID 105268450
[(4-chloro-1-methylpyrazol-5-yl)-(3,5-dibromo-2-pyridinyl)methyl]hydrazine (PubChem CID 105268450) has the molecular formula C10H10Br2ClN5 and a molecular weight of 395.49 g/mol. Its IUPAC name is [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dibromo-2-pyridinyl)methyl]hydrazine.
| Compound Name | [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dibromo-2-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105268450 |
| Molecular Formula | C10H10Br2ClN5 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dibromo-2-pyridinyl)methyl]hydrazine |
| SMILES | Cn1ncc(Cl)c1C(NN)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C10H10Br2ClN5/c1-18-10(7(13)4-16-18)9(17-14)8-6(12)2-5(11)3-15-8/h2-4,9,17H,14H2,1H3 |
| InChIKey | SWWCPUIJQNVYBV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|