C11H11Cl3N4 — CID 105338868
[(4-chloro-1-methylpyrazol-5-yl)-(3,5-dichlorophenyl)methyl]hydrazine (PubChem CID 105338868) has the molecular formula C11H11Cl3N4 and a molecular weight of 305.60 g/mol. Its IUPAC name is [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dichlorophenyl)methyl]hydrazine.
| Compound Name | [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105338868 |
| Molecular Formula | C11H11Cl3N4 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [(4-chloro-1-methylpyrazol-5-yl)-(3,5-dichlorophenyl)methyl]hydrazine |
| SMILES | Cn1ncc(Cl)c1C(NN)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H11Cl3N4/c1-18-11(9(14)5-16-18)10(17-15)6-2-7(12)4-8(13)3-6/h2-5,10,17H,15H2,1H3 |
| InChIKey | JALCZRJVIANUEQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|