C9H10Cl2N4O — CID 106694761
[(5-chlorofuran-2-yl)-(4-chloro-1-methylpyrazol-5-yl)methyl]hydrazine (PubChem CID 106694761) has the molecular formula C9H10Cl2N4O and a molecular weight of 261.11 g/mol. Its IUPAC name is [(5-chlorofuran-2-yl)-(4-chloro-1-methylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(5-chlorofuran-2-yl)-(4-chloro-1-methylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106694761 |
| Molecular Formula | C9H10Cl2N4O |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | [(5-chlorofuran-2-yl)-(4-chloro-1-methylpyrazol-5-yl)methyl]hydrazine |
| SMILES | Cn1ncc(Cl)c1C(NN)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H10Cl2N4O/c1-15-9(5(10)4-13-15)8(14-12)6-2-3-7(11)16-6/h2-4,8,14H,12H2,1H3 |
| InChIKey | SYQMPMLILMKYIQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|