C17H18I+ — CID 10526902
[(E)-2-phenylethenyl]-(2,4,6-trimethylphenyl)iodanium (PubChem CID 10526902) has the molecular formula C17H18I+ and a molecular weight of 349.24 g/mol. Its IUPAC name is [(E)-2-phenylethenyl]-(2,4,6-trimethylphenyl)iodanium.
| Compound Name | [(E)-2-phenylethenyl]-(2,4,6-trimethylphenyl)iodanium |
|---|---|
| PubChem CID | 10526902 |
| Molecular Formula | C17H18I+ |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | [(E)-2-phenylethenyl]-(2,4,6-trimethylphenyl)iodanium |
| SMILES | Cc1cc(C)c([I+]/C=C/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H18I/c1-13-11-14(2)17(15(3)12-13)18-10-9-16-7-5-4-6-8-16/h4-12H,1-3H3/q+1/b10-9+ |
| InChIKey | DQCJURQFYJROHC-MDZDMXLPSA-N |
| XLogP | 1.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|