C17H26N2 — CID 105269865
[1-(cyclohexen-1-yl)-3-(4-ethylphenyl)propan-2-yl]hydrazine (PubChem CID 105269865) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-3-(4-ethylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(cyclohexen-1-yl)-3-(4-ethylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105269865 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | [1-(cyclohexen-1-yl)-3-(4-ethylphenyl)propan-2-yl]hydrazine |
| SMILES | CCc1ccc(CC(CC2=CCCCC2)NN)cc1 |
| InChI | InChI=1S/C17H26N2/c1-2-14-8-10-16(11-9-14)13-17(19-18)12-15-6-4-3-5-7-15/h6,8-11,17,19H,2-5,7,12-13,18H2,1H3 |
| InChIKey | ZGGAQEKDVFXDNL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|