C17H23F2N — CID 116661708
1-(cyclohexen-1-yl)-3-(3,4-difluorophenyl)-N-ethylpropan-2-amine (PubChem CID 116661708) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(3,4-difluorophenyl)-N-ethylpropan-2-amine.
| Compound Name | 1-(cyclohexen-1-yl)-3-(3,4-difluorophenyl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 116661708 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(3,4-difluorophenyl)-N-ethylpropan-2-amine |
| SMILES | CCNC(CC1=CCCCC1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H23F2N/c1-2-20-15(10-13-6-4-3-5-7-13)11-14-8-9-16(18)17(19)12-14/h6,8-9,12,15,20H,2-5,7,10-11H2,1H3 |
| InChIKey | UACFVLVMXOKOAE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|