C10H19F3N2O — CID 105270306
[5,5,5-trifluoro-1-(1-methoxycyclobutyl)pentyl]hydrazine (PubChem CID 105270306) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(1-methoxycyclobutyl)pentyl]hydrazine.
| Compound Name | [5,5,5-trifluoro-1-(1-methoxycyclobutyl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105270306 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [5,5,5-trifluoro-1-(1-methoxycyclobutyl)pentyl]hydrazine |
| SMILES | COC1(C(CCCC(F)(F)F)NN)CCC1 |
| InChI | InChI=1S/C10H19F3N2O/c1-16-9(5-3-6-9)8(15-14)4-2-7-10(11,12)13/h8,15H,2-7,14H2,1H3 |
| InChIKey | CKXHAAQRBXWFRC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|