C14H24N2O3 — CID 105271639
[1-(3,4-dimethoxyphenyl)-2-methoxypentyl]hydrazine (PubChem CID 105271639) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-2-methoxypentyl]hydrazine.
| Compound Name | [1-(3,4-dimethoxyphenyl)-2-methoxypentyl]hydrazine |
|---|---|
| PubChem CID | 105271639 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-2-methoxypentyl]hydrazine |
| SMILES | CCCC(OC)C(NN)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H24N2O3/c1-5-6-12(18-3)14(16-15)10-7-8-11(17-2)13(9-10)19-4/h7-9,12,14,16H,5-6,15H2,1-4H3 |
| InChIKey | ZVAWWZWZKZQVCK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|