C12H20N4O — CID 105272937
3-(2-cyclopropyl-1-hydrazinyl-2-methoxyethyl)-5-methylpyridin-2-amine (PubChem CID 105272937) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2-cyclopropyl-1-hydrazinyl-2-methoxyethyl)-5-methylpyridin-2-amine.
| Compound Name | 3-(2-cyclopropyl-1-hydrazinyl-2-methoxyethyl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105272937 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-(2-cyclopropyl-1-hydrazinyl-2-methoxyethyl)-5-methylpyridin-2-amine |
| SMILES | COC(C1CC1)C(NN)c1cc(C)cnc1N |
| InChI | InChI=1S/C12H20N4O/c1-7-5-9(12(13)15-6-7)10(16-14)11(17-2)8-3-4-8/h5-6,8,10-11,16H,3-4,14H2,1-2H3,(H2,13,15) |
| InChIKey | BUZXMOSQGJVHCD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|