C13H20N2O — CID 105272618
[2-cyclopropyl-2-methoxy-1-(2-methylphenyl)ethyl]hydrazine (PubChem CID 105272618) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [2-cyclopropyl-2-methoxy-1-(2-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-cyclopropyl-2-methoxy-1-(2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105272618 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [2-cyclopropyl-2-methoxy-1-(2-methylphenyl)ethyl]hydrazine |
| SMILES | COC(C1CC1)C(NN)c1ccccc1C |
| InChI | InChI=1S/C13H20N2O/c1-9-5-3-4-6-11(9)12(15-14)13(16-2)10-7-8-10/h3-6,10,12-13,15H,7-8,14H2,1-2H3 |
| InChIKey | NUVDSWUQQJSFHL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|