C14H24N2OS — CID 102843105
[2-cyclohexyl-2-methoxy-1-(2-methylthiophen-3-yl)ethyl]hydrazine (PubChem CID 102843105) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is [2-cyclohexyl-2-methoxy-1-(2-methylthiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-cyclohexyl-2-methoxy-1-(2-methylthiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102843105 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [2-cyclohexyl-2-methoxy-1-(2-methylthiophen-3-yl)ethyl]hydrazine |
| SMILES | COC(C1CCCCC1)C(NN)c1ccsc1C |
| InChI | InChI=1S/C14H24N2OS/c1-10-12(8-9-18-10)13(16-15)14(17-2)11-6-4-3-5-7-11/h8-9,11,13-14,16H,3-7,15H2,1-2H3 |
| InChIKey | NWQQIYSWEBOMCS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|