C13H27N5O — CID 105273812
[3-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)-4,4-dimethylpentan-2-yl]hydrazine (PubChem CID 105273812) has the molecular formula C13H27N5O and a molecular weight of 269.39 g/mol. Its IUPAC name is [3-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)-4,4-dimethylpentan-2-yl]hydrazine.
| Compound Name | [3-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)-4,4-dimethylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105273812 |
| Molecular Formula | C13H27N5O |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | [3-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)-4,4-dimethylpentan-2-yl]hydrazine |
| SMILES | CCOC(C(Cc1ncnn1CC)NN)C(C)(C)C |
| InChI | InChI=1S/C13H27N5O/c1-6-18-11(15-9-16-18)8-10(17-14)12(19-7-2)13(3,4)5/h9-10,12,17H,6-8,14H2,1-5H3 |
| InChIKey | JNGWXJRKCAXECL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|