C15H30N2O2S — CID 105274344
[2-methoxy-2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butyl]hydrazine (PubChem CID 105274344) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is [2-methoxy-2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butyl]hydrazine.
| Compound Name | [2-methoxy-2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105274344 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [2-methoxy-2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butyl]hydrazine |
| SMILES | CCC(C)(OC)C(NN)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C15H30N2O2S/c1-4-14(2,18-3)13(17-16)12-5-8-19-15(11-12)6-9-20-10-7-15/h12-13,17H,4-11,16H2,1-3H3 |
| InChIKey | OYAPGZAULDHWGD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|