C17H33NO2S — CID 116758127
2-methoxy-2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-N-propylbutan-1-amine (PubChem CID 116758127) has the molecular formula C17H33NO2S and a molecular weight of 315.52 g/mol. Its IUPAC name is 2-methoxy-2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-N-propylbutan-1-amine.
| Compound Name | 2-methoxy-2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 116758127 |
| Molecular Formula | C17H33NO2S |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-methoxy-2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-N-propylbutan-1-amine |
| SMILES | CCCNC(C1CCOC2(CCSC2)C1)C(C)(CC)OC |
| InChI | InChI=1S/C17H33NO2S/c1-5-9-18-15(16(3,6-2)19-4)14-7-10-20-17(12-14)8-11-21-13-17/h14-15,18H,5-13H2,1-4H3 |
| InChIKey | KWHBHDKCXFWUTL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |