C22H31ClN4O4 — CID 10527580
(3S)-3-(6-chloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 10527580) has the molecular formula C22H31ClN4O4 and a molecular weight of 450.97 g/mol. Its IUPAC name is (3S)-3-(6-chloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(6-chloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10527580 |
| Molecular Formula | C22H31ClN4O4 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (3S)-3-(6-chloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H31ClN4O4/c23-19-5-4-16(13-25-19)18(12-21(29)30)26-22(31)17-2-1-11-27(14-17)20(28)6-3-15-7-9-24-10-8-15/h4-5,13,15,17-18,24H,1-3,6-12,14H2,(H,26,31)(H,29,30)/t17-,18+/m1/s1 |
| InChIKey | AQNSLCJLLMFYBT-MSOLQXFVSA-N |
| XLogP | 2.39 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|