C20H25ClN8O3 — CID 10527981
(3S,6S,9R)-6-benzyl-16-chloro-3-methyl-4,7-dioxo-2,5,8,13,15,17,18-heptazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-9-carboxamide (PubChem CID 10527981) has the molecular formula C20H25ClN8O3 and a molecular weight of 460.93 g/mol. Its IUPAC name is (3S,6S,9R)-6-benzyl-16-chloro-3-methyl-4,7-dioxo-2,5,8,13,15,17,18-heptazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-9-carboxamide.
| Compound Name | (3S,6S,9R)-6-benzyl-16-chloro-3-methyl-4,7-dioxo-2,5,8,13,15,17,18-heptazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-9-carboxamide |
|---|---|
| PubChem CID | 10527981 |
| Molecular Formula | C20H25ClN8O3 |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (3S,6S,9R)-6-benzyl-16-chloro-3-methyl-4,7-dioxo-2,5,8,13,15,17,18-heptazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-9-carboxamide |
| SMILES | C[C@@H]1Nc2nc(Cl)nc(n2)NCCC[C@H](C(N)=O)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C20H25ClN8O3/c1-11-16(31)26-14(10-12-6-3-2-4-7-12)17(32)25-13(15(22)30)8-5-9-23-19-27-18(21)28-20(24-11)29-19/h2-4,6-7,11,13-14H,5,8-10H2,1H3,(H2,22,30)(H,25,32)(H,26,31)(H2,23,24,27,28,29)/t11-,13+,14-/m0/s1 |
| InChIKey | SBFBPTJMAPNMBB-YUTCNCBUSA-N |
| XLogP | 0.23 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |