C28H35N7O7 — CID 101250270
(3S,13S,16S)-6-benzyl-3,16-dimethyl-21-nitro-4,7,15,18-tetraoxo-2,5,8,14,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-13-carboxamide (PubChem CID 101250270) has the molecular formula C28H35N7O7 and a molecular weight of 581.63 g/mol. Its IUPAC name is (3S,13S,16S)-6-benzyl-3,16-dimethyl-21-nitro-4,7,15,18-tetraoxo-2,5,8,14,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-13-carboxamide.
| Compound Name | (3S,13S,16S)-6-benzyl-3,16-dimethyl-21-nitro-4,7,15,18-tetraoxo-2,5,8,14,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-13-carboxamide |
|---|---|
| PubChem CID | 101250270 |
| Molecular Formula | C28H35N7O7 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (3S,13S,16S)-6-benzyl-3,16-dimethyl-21-nitro-4,7,15,18-tetraoxo-2,5,8,14,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-13-carboxamide |
| SMILES | C[C@@H]1NC(=O)c2ccc(c([N+](=O)[O-])c2)N[C@@H](C)C(=O)NC(Cc2ccccc2)C(=O)NCCCC[C@@H](C(N)=O)NC1=O |
| InChI | InChI=1S/C28H35N7O7/c1-16-25(37)34-22(14-18-8-4-3-5-9-18)28(40)30-13-7-6-10-21(24(29)36)33-26(38)17(2)32-27(39)19-11-12-20(31-16)23(15-19)35(41)42/h3-5,8-9,11-12,15-17,21-22,31H,6-7,10,13-14H2,1-2H3,(H2,29,36)(H,30,40)(H,32,39)(H,33,38)(H,34,37)/t16-,17-,21-,22?/m0/s1 |
| InChIKey | HEXILYNHGNBHFP-GDGRWMROSA-N |
| XLogP | 0.51 |
| TPSA | 214.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|