C26H30N6O7 — CID 54294314
2-[11-[(4-aminophenyl)methyl]-14-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetic acid (PubChem CID 54294314) has the molecular formula C26H30N6O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is 2-[11-[(4-aminophenyl)methyl]-14-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetic acid.
| Compound Name | 2-[11-[(4-aminophenyl)methyl]-14-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetic acid |
|---|---|
| PubChem CID | 54294314 |
| Molecular Formula | C26H30N6O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[11-[(4-aminophenyl)methyl]-14-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetic acid |
| SMILES | CC1NC(=O)c2cccc(c2)CNC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(Cc2ccc(N)cc2)NC1=O |
| InChI | InChI=1S/C26H30N6O7/c1-14-23(36)32-19(10-15-5-7-18(27)8-6-15)25(38)29-13-21(33)31-20(11-22(34)35)26(39)28-12-16-3-2-4-17(9-16)24(37)30-14/h2-9,14,19-20H,10-13,27H2,1H3,(H,28,39)(H,29,38)(H,30,37)(H,31,33)(H,32,36)(H,34,35) |
| InChIKey | YNCGWKRUSDZWMD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|