C24H35N3O6 — CID 10528003
benzyl N-[(2S)-1-[[1,2-dioxo-1-(oxolan-2-ylmethylamino)pentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 10528003) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[1,2-dioxo-1-(oxolan-2-ylmethylamino)pentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[1,2-dioxo-1-(oxolan-2-ylmethylamino)pentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10528003 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | benzyl N-[(2S)-1-[[1,2-dioxo-1-(oxolan-2-ylmethylamino)pentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C24H35N3O6/c1-4-19(21(28)23(30)25-14-18-11-8-12-32-18)26-22(29)20(13-16(2)3)27-24(31)33-15-17-9-6-5-7-10-17/h5-7,9-10,16,18-20H,4,8,11-15H2,1-3H3,(H,25,30)(H,26,29)(H,27,31)/t18?,19?,20-/m0/s1 |
| InChIKey | CZPUWGZBBOMJKE-MHJFOBGBSA-N |
| XLogP | 2.09 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|