C21H19F3N2O5S — CID 10528268
[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2,2,2-trifluoroacetate (PubChem CID 10528268) has the molecular formula C21H19F3N2O5S and a molecular weight of 468.45 g/mol. Its IUPAC name is [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10528268 |
| Molecular Formula | C21H19F3N2O5S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2,2,2-trifluoroacetate |
| SMILES | CCc1ccc(C(COc2ccc(CC3SC(=O)NC3=O)cc2)OC(=O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C21H19F3N2O5S/c1-2-12-5-8-15(25-10-12)16(31-19(28)21(22,23)24)11-30-14-6-3-13(4-7-14)9-17-18(27)26-20(29)32-17/h3-8,10,16-17H,2,9,11H2,1H3,(H,26,27,29) |
| InChIKey | CIHSCLPKUBEVFH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|