C27H52N2O4 — CID 10528294
(3R)-3-[[3,3-dimethyl-1-oxo-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]carbamoyl]dodecanoic acid (PubChem CID 10528294) has the molecular formula C27H52N2O4 and a molecular weight of 468.72 g/mol. Its IUPAC name is (3R)-3-[[3,3-dimethyl-1-oxo-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]carbamoyl]dodecanoic acid.
| Compound Name | (3R)-3-[[3,3-dimethyl-1-oxo-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]carbamoyl]dodecanoic acid |
|---|---|
| PubChem CID | 10528294 |
| Molecular Formula | C27H52N2O4 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.39 |
| IUPAC Name | (3R)-3-[[3,3-dimethyl-1-oxo-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]carbamoyl]dodecanoic acid |
| SMILES | CCCCCCCCC[C@H](CC(=O)O)C(=O)NC(C(=O)NC(C)(C)CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H52N2O4/c1-10-11-12-13-14-15-16-17-20(18-21(30)31)23(32)28-22(26(5,6)7)24(33)29-27(8,9)19-25(2,3)4/h20,22H,10-19H2,1-9H3,(H,28,32)(H,29,33)(H,30,31)/t20-,22?/m1/s1 |
| InChIKey | NZGCTIHXWWEUIB-PSDZMVHGSA-N |
| XLogP | 6.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|