C13H18N4S — CID 105284851
[(3-methylphenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine (PubChem CID 105284851) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is [(3-methylphenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [(3-methylphenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105284851 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [(3-methylphenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine |
| SMILES | CCCc1nnsc1C(NN)c1cccc(C)c1 |
| InChI | InChI=1S/C13H18N4S/c1-3-5-11-13(18-17-16-11)12(15-14)10-7-4-6-9(2)8-10/h4,6-8,12,15H,3,5,14H2,1-2H3 |
| InChIKey | QYCKQUUOERDKIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|