C12H14F2N4S — CID 105308059
[(2,6-difluorophenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine (PubChem CID 105308059) has the molecular formula C12H14F2N4S and a molecular weight of 284.33 g/mol. Its IUPAC name is [(2,6-difluorophenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [(2,6-difluorophenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105308059 |
| Molecular Formula | C12H14F2N4S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(2,6-difluorophenyl)-(4-propylthiadiazol-5-yl)methyl]hydrazine |
| SMILES | CCCc1nnsc1C(NN)c1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2N4S/c1-2-4-9-12(19-18-17-9)11(16-15)10-7(13)5-3-6-8(10)14/h3,5-6,11,16H,2,4,15H2,1H3 |
| InChIKey | ANDPGFVEYIQRLO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|