C13H15F2N3S — CID 105190680
2-(2,6-difluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanamine (PubChem CID 105190680) has the molecular formula C13H15F2N3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(2,6-difluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105190680 |
| Molecular Formula | C13H15F2N3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanamine |
| SMILES | CCCc1nnsc1C(N)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H15F2N3S/c1-2-4-12-13(19-18-17-12)11(16)7-8-9(14)5-3-6-10(8)15/h3,5-6,11H,2,4,7,16H2,1H3 |
| InChIKey | WSZMQBIQPVJFMK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |