C23H41NO2Sn — CID 10528779
N-[(4-methoxyphenyl)methyl]-N-(tributylstannylmethyl)acetamide (PubChem CID 10528779) has the molecular formula C23H41NO2Sn and a molecular weight of 482.30 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-(tributylstannylmethyl)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-(tributylstannylmethyl)acetamide |
|---|---|
| PubChem CID | 10528779 |
| Molecular Formula | C23H41NO2Sn |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-(tributylstannylmethyl)acetamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)CN(Cc1ccc(OC)cc1)C(C)=O |
| InChI | InChI=1S/C11H14NO2.3C4H9.Sn/c1-9(13)12(2)8-10-4-6-11(14-3)7-5-10;3*1-3-4-2;/h4-7H,2,8H2,1,3H3;3*1,3-4H2,2H3; |
| InChIKey | ZNUZRIHPIZEDRK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |