C26H31NO8 — CID 10528900
methyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[acetyloxy(benzyl)amino]acetate (PubChem CID 10528900) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is methyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[acetyloxy(benzyl)amino]acetate.
| Compound Name | methyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[acetyloxy(benzyl)amino]acetate |
|---|---|
| PubChem CID | 10528900 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | methyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[acetyloxy(benzyl)amino]acetate |
| SMILES | COC(=O)[C@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)N(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C26H31NO8/c1-17(28)35-27(15-18-11-7-5-8-12-18)20(24(29)30-4)21-22(31-16-19-13-9-6-10-14-19)23-25(32-21)34-26(2,3)33-23/h5-14,20-23,25H,15-16H2,1-4H3/t20-,21+,22-,23+,25+/m0/s1 |
| InChIKey | QZVPLAQJZOQXSY-ZFAFIAQSSA-N |
| XLogP | 2.97 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|