C13H18N2O — CID 105289693
1-(3,4-dihydro-1H-isochromen-1-yl)but-3-enylhydrazine (PubChem CID 105289693) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-yl)but-3-enylhydrazine.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-yl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105289693 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-yl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)C1OCCc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-2-5-12(15-14)13-11-7-4-3-6-10(11)8-9-16-13/h2-4,6-7,12-13,15H,1,5,8-9,14H2 |
| InChIKey | XCSZHNQCSFCUBB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|