C14H22N2O — CID 105293861
1-(3,4-dihydro-1H-isochromen-1-yl)pentylhydrazine (PubChem CID 105293861) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-yl)pentylhydrazine.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-yl)pentylhydrazine |
|---|---|
| PubChem CID | 105293861 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-yl)pentylhydrazine |
| SMILES | CCCCC(NN)C1OCCc2ccccc21 |
| InChI | InChI=1S/C14H22N2O/c1-2-3-8-13(16-15)14-12-7-5-4-6-11(12)9-10-17-14/h4-7,13-14,16H,2-3,8-10,15H2,1H3 |
| InChIKey | LINJVEHCZDIZHA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|