C11H16F2N2O2S — CID 105290950
[1-(2,3-difluorophenyl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 105290950) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is [1-(2,3-difluorophenyl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(2,3-difluorophenyl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 105290950 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [1-(2,3-difluorophenyl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)c1cccc(F)c1F |
| InChI | InChI=1S/C11H16F2N2O2S/c1-18(16,17)7-3-6-10(15-14)8-4-2-5-9(12)11(8)13/h2,4-5,10,15H,3,6-7,14H2,1H3 |
| InChIKey | KECTXKMXJLVNSF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|