C12H17F2NO2S — CID 103915804
N-[1-(2,3-difluorophenyl)ethyl]-3-methylsulfonylpropan-1-amine (PubChem CID 103915804) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[1-(2,3-difluorophenyl)ethyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[1-(2,3-difluorophenyl)ethyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 103915804 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-[1-(2,3-difluorophenyl)ethyl]-3-methylsulfonylpropan-1-amine |
| SMILES | CC(NCCCS(C)(=O)=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H17F2NO2S/c1-9(15-7-4-8-18(2,16)17)10-5-3-6-11(13)12(10)14/h3,5-6,9,15H,4,7-8H2,1-2H3 |
| InChIKey | PJMCITTZLFFDHQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|