C11H22N4O2S2 — CID 105291025
[1-(4-tert-butylthiadiazol-5-yl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 105291025) has the molecular formula C11H22N4O2S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is [1-(4-tert-butylthiadiazol-5-yl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(4-tert-butylthiadiazol-5-yl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 105291025 |
| Molecular Formula | C11H22N4O2S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [1-(4-tert-butylthiadiazol-5-yl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | CC(C)(C)c1nnsc1C(CCCS(C)(=O)=O)NN |
| InChI | InChI=1S/C11H22N4O2S2/c1-11(2,3)10-9(18-15-14-10)8(13-12)6-5-7-19(4,16)17/h8,13H,5-7,12H2,1-4H3 |
| InChIKey | PWGBKWCDCCAFAC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|