C9H18N4O2S2 — CID 114985237
[3-methylsulfonyl-1-(4-propan-2-ylthiadiazol-5-yl)propyl]hydrazine (PubChem CID 114985237) has the molecular formula C9H18N4O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is [3-methylsulfonyl-1-(4-propan-2-ylthiadiazol-5-yl)propyl]hydrazine.
| Compound Name | [3-methylsulfonyl-1-(4-propan-2-ylthiadiazol-5-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 114985237 |
| Molecular Formula | C9H18N4O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [3-methylsulfonyl-1-(4-propan-2-ylthiadiazol-5-yl)propyl]hydrazine |
| SMILES | CC(C)c1nnsc1C(CCS(C)(=O)=O)NN |
| InChI | InChI=1S/C9H18N4O2S2/c1-6(2)8-9(16-13-12-8)7(11-10)4-5-17(3,14)15/h6-7,11H,4-5,10H2,1-3H3 |
| InChIKey | VDQQEWHZSVNYHQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|