C11H22N4OS — CID 105338088
[4-methoxy-2-methyl-1-(4-propan-2-ylthiadiazol-5-yl)butyl]hydrazine (PubChem CID 105338088) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is [4-methoxy-2-methyl-1-(4-propan-2-ylthiadiazol-5-yl)butyl]hydrazine.
| Compound Name | [4-methoxy-2-methyl-1-(4-propan-2-ylthiadiazol-5-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105338088 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [4-methoxy-2-methyl-1-(4-propan-2-ylthiadiazol-5-yl)butyl]hydrazine |
| SMILES | COCCC(C)C(NN)c1snnc1C(C)C |
| InChI | InChI=1S/C11H22N4OS/c1-7(2)9-11(17-15-14-9)10(13-12)8(3)5-6-16-4/h7-8,10,13H,5-6,12H2,1-4H3 |
| InChIKey | XAOUSZSMICCZCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|