C16H22N4 — CID 105292629
[(2,5-dimethylphenyl)-(3-ethyl-6-methylpyridazin-4-yl)methyl]hydrazine (PubChem CID 105292629) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is [(2,5-dimethylphenyl)-(3-ethyl-6-methylpyridazin-4-yl)methyl]hydrazine.
| Compound Name | [(2,5-dimethylphenyl)-(3-ethyl-6-methylpyridazin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105292629 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(2,5-dimethylphenyl)-(3-ethyl-6-methylpyridazin-4-yl)methyl]hydrazine |
| SMILES | CCc1nnc(C)cc1C(NN)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H22N4/c1-5-15-14(9-12(4)19-20-15)16(18-17)13-8-10(2)6-7-11(13)3/h6-9,16,18H,5,17H2,1-4H3 |
| InChIKey | ZBLJUAFBTUIHHX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|