C10H14N4 — CID 105315660
1-(3-ethyl-6-methylpyridazin-4-yl)prop-2-ynylhydrazine (PubChem CID 105315660) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(3-ethyl-6-methylpyridazin-4-yl)prop-2-ynylhydrazine.
| Compound Name | 1-(3-ethyl-6-methylpyridazin-4-yl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105315660 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(3-ethyl-6-methylpyridazin-4-yl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1cc(C)nnc1CC |
| InChI | InChI=1S/C10H14N4/c1-4-9(12-11)8-6-7(3)13-14-10(8)5-2/h1,6,9,12H,5,11H2,2-3H3 |
| InChIKey | CWDIKEWHQIVJRQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|