C13H14BrFN4 — CID 105297058
[2-(2-bromo-5-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine (PubChem CID 105297058) has the molecular formula C13H14BrFN4 and a molecular weight of 325.19 g/mol. Its IUPAC name is [2-(2-bromo-5-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-5-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105297058 |
| Molecular Formula | C13H14BrFN4 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [2-(2-bromo-5-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine |
| SMILES | Cc1cnc(C(Cc2cc(F)ccc2Br)NN)cn1 |
| InChI | InChI=1S/C13H14BrFN4/c1-8-6-18-13(7-17-8)12(19-16)5-9-4-10(15)2-3-11(9)14/h2-4,6-7,12,19H,5,16H2,1H3 |
| InChIKey | DSVRYEDXJMBCGH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|