C13H14ClFN4 — CID 105342735
[2-(4-chloro-2-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine (PubChem CID 105342735) has the molecular formula C13H14ClFN4 and a molecular weight of 280.73 g/mol. Its IUPAC name is [2-(4-chloro-2-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-2-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105342735 |
| Molecular Formula | C13H14ClFN4 |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [2-(4-chloro-2-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethyl]hydrazine |
| SMILES | Cc1cnc(C(Cc2ccc(Cl)cc2F)NN)cn1 |
| InChI | InChI=1S/C13H14ClFN4/c1-8-6-18-13(7-17-8)12(19-16)4-9-2-3-10(14)5-11(9)15/h2-3,5-7,12,19H,4,16H2,1H3 |
| InChIKey | AVLGLULYBIECIF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|