C17H29ClN2O — CID 105297547
[1-(5-chloro-2-methoxyphenyl)-4,6,6-trimethylheptan-2-yl]hydrazine (PubChem CID 105297547) has the molecular formula C17H29ClN2O and a molecular weight of 312.88 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxyphenyl)-4,6,6-trimethylheptan-2-yl]hydrazine.
| Compound Name | [1-(5-chloro-2-methoxyphenyl)-4,6,6-trimethylheptan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105297547 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [1-(5-chloro-2-methoxyphenyl)-4,6,6-trimethylheptan-2-yl]hydrazine |
| SMILES | COc1ccc(Cl)cc1CC(CC(C)CC(C)(C)C)NN |
| InChI | InChI=1S/C17H29ClN2O/c1-12(11-17(2,3)4)8-15(20-19)10-13-9-14(18)6-7-16(13)21-5/h6-7,9,12,15,20H,8,10-11,19H2,1-5H3 |
| InChIKey | INXAUGKQVTZYIG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|