C12H22N4 — CID 105299111
[2-cyclopentyl-1-(2,5-dimethylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105299111) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [2-cyclopentyl-1-(2,5-dimethylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-cyclopentyl-1-(2,5-dimethylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105299111 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [2-cyclopentyl-1-(2,5-dimethylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(CC2CCCC2)NN)n(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-9-7-12(16(2)15-9)11(14-13)8-10-5-3-4-6-10/h7,10-11,14H,3-6,8,13H2,1-2H3 |
| InChIKey | SXNVNXJOCHVSRU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|