C9H15F3N4 — CID 105313929
[1-(2,5-dimethylpyrazol-3-yl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105313929) has the molecular formula C9H15F3N4 and a molecular weight of 236.24 g/mol. Its IUPAC name is [1-(2,5-dimethylpyrazol-3-yl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(2,5-dimethylpyrazol-3-yl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105313929 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [1-(2,5-dimethylpyrazol-3-yl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | Cc1cc(C(CCC(F)(F)F)NN)n(C)n1 |
| InChI | InChI=1S/C9H15F3N4/c1-6-5-8(16(2)15-6)7(14-13)3-4-9(10,11)12/h5,7,14H,3-4,13H2,1-2H3 |
| InChIKey | BCGGNIGIVALIKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|