C23H24N2O3 — CID 1053006
1-[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-naphthalen-1-ylurea (PubChem CID 1053006) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 1053006 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-naphthalen-1-ylurea |
| SMILES | CC1(C)OC[C@@H](NC(=O)Nc2cccc3ccccc23)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H24N2O3/c1-23(2)27-15-20(21(28-23)17-10-4-3-5-11-17)25-22(26)24-19-14-8-12-16-9-6-7-13-18(16)19/h3-14,20-21H,15H2,1-2H3,(H2,24,25,26)/t20-,21+/m1/s1 |
| InChIKey | SBTFAAZRFNIVMQ-RTWAWAEBSA-N |
| XLogP | 4.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |