C31H26ClN3OS — CID 10530074
3-chloro-N-[2-(1-tritylsulfanylimidazol-4-yl)ethyl]benzamide (PubChem CID 10530074) has the molecular formula C31H26ClN3OS and a molecular weight of 524.09 g/mol. Its IUPAC name is 3-chloro-N-[2-(1-tritylsulfanylimidazol-4-yl)ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-(1-tritylsulfanylimidazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 10530074 |
| Molecular Formula | C31H26ClN3OS |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 3-chloro-N-[2-(1-tritylsulfanylimidazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cn(SC(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H26ClN3OS/c32-28-18-10-11-24(21-28)30(36)33-20-19-29-22-35(23-34-29)37-31(25-12-4-1-5-13-25,26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-18,21-23H,19-20H2,(H,33,36) |
| InChIKey | QNTHPPNUFPRHRF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|