C18H27FN2 — CID 105302141
[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine (PubChem CID 105302141) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine.
| Compound Name | [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105302141 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-fluoro-2-methylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(F)cc1C(NN)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H27FN2/c1-12-6-9-16(19)11-17(12)18(21-20)15-8-7-13-4-2-3-5-14(13)10-15/h6,9,11,13-15,18,21H,2-5,7-8,10,20H2,1H3 |
| InChIKey | ZAHFNFWNUVPAEI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|