C18H25ClFN — CID 105397031
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-chloro-5-fluorophenyl)-N-methylmethanamine (PubChem CID 105397031) has the molecular formula C18H25ClFN and a molecular weight of 309.86 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-chloro-5-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-chloro-5-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105397031 |
| Molecular Formula | C18H25ClFN |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-chloro-5-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)ccc1Cl)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H25ClFN/c1-21-18(16-11-15(20)8-9-17(16)19)14-7-6-12-4-2-3-5-13(12)10-14/h8-9,11-14,18,21H,2-7,10H2,1H3 |
| InChIKey | PCQVBJLRQKWDOA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |