C18H25F2N — CID 115859863
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2,6-difluorophenyl)-N-methylmethanamine (PubChem CID 115859863) has the molecular formula C18H25F2N and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2,6-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2,6-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115859863 |
| Molecular Formula | C18H25F2N |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2,6-difluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1c(F)cccc1F)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H25F2N/c1-21-18(17-15(19)7-4-8-16(17)20)14-10-9-12-5-2-3-6-13(12)11-14/h4,7-8,12-14,18,21H,2-3,5-6,9-11H2,1H3 |
| InChIKey | RQTBQCAEGVOJTJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |