C15H18ClF4N — CID 105397310
1-(2-chloro-5-fluorophenyl)-N-methyl-1-[3-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 105397310) has the molecular formula C15H18ClF4N and a molecular weight of 323.76 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-N-methyl-1-[3-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-N-methyl-1-[3-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 105397310 |
| Molecular Formula | C15H18ClF4N |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-N-methyl-1-[3-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | CNC(c1cc(F)ccc1Cl)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H18ClF4N/c1-21-14(12-8-11(17)5-6-13(12)16)9-3-2-4-10(7-9)15(18,19)20/h5-6,8-10,14,21H,2-4,7H2,1H3 |
| InChIKey | YOCSVNNFXCOLEC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |