C9H8F2N4S — CID 105303327
[(2,5-difluorophenyl)-(thiadiazol-4-yl)methyl]hydrazine (PubChem CID 105303327) has the molecular formula C9H8F2N4S and a molecular weight of 242.25 g/mol. Its IUPAC name is [(2,5-difluorophenyl)-(thiadiazol-4-yl)methyl]hydrazine.
| Compound Name | [(2,5-difluorophenyl)-(thiadiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105303327 |
| Molecular Formula | C9H8F2N4S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [(2,5-difluorophenyl)-(thiadiazol-4-yl)methyl]hydrazine |
| SMILES | NNC(c1csnn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H8F2N4S/c10-5-1-2-7(11)6(3-5)9(13-12)8-4-16-15-14-8/h1-4,9,13H,12H2 |
| InChIKey | BGAJUQLMWUPCHT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|