C17H21FN2O — CID 105304055
[1-(3-fluoro-4-methoxyphenyl)-3-(3-methylphenyl)propyl]hydrazine (PubChem CID 105304055) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is [1-(3-fluoro-4-methoxyphenyl)-3-(3-methylphenyl)propyl]hydrazine.
| Compound Name | [1-(3-fluoro-4-methoxyphenyl)-3-(3-methylphenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 105304055 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [1-(3-fluoro-4-methoxyphenyl)-3-(3-methylphenyl)propyl]hydrazine |
| SMILES | COc1ccc(C(CCc2cccc(C)c2)NN)cc1F |
| InChI | InChI=1S/C17H21FN2O/c1-12-4-3-5-13(10-12)6-8-16(20-19)14-7-9-17(21-2)15(18)11-14/h3-5,7,9-11,16,20H,6,8,19H2,1-2H3 |
| InChIKey | HEUVZPZBQWCOCF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|